2-nitro-1-naphthylamine
Modify Date: 2025-08-25 12:54:03
2-nitro-1-naphthylamine structure
|
Common Name | 2-nitro-1-naphthylamine | ||
|---|---|---|---|---|
| CAS Number | 607-23-8 | Molecular Weight | 188.18300 | |
| Density | 1.366g/cm3 | Boiling Point | 390.8ºC at 760 mmHg | |
| Molecular Formula | C10H8N2O2 | Melting Point | 144ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-nitronaphthalen-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 390.8ºC at 760 mmHg |
| Melting Point | 144ºC |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18300 |
| Exact Mass | 188.05900 |
| PSA | 71.84000 |
| LogP | 3.43460 |
| Index of Refraction | 1.728 |
| InChIKey | SMAJHKXZBICXLS-UHFFFAOYSA-N |
| SMILES | Nc1c([N+](=O)[O-])ccc2ccccc12 |
| HS Code | 2921450090 |
|---|
| HS Code | 2921450090 |
|---|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-nitro-1-naphthalenamine |
| 2-nitronaphthylamine |
| 2-NITRO-1-NAPHTHYLAMINE |
| 1-amino-2-nitronaphthalene |
| 1-Naphthalenamine,2-nitro |
| 2-Nitro-naphthalen-1-ylamine |
| 2-Nitro-1-amino-naphthalin |