Phenylalanine,N-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)acetyl]- (9CI) structure
|
Common Name | Phenylalanine,N-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)acetyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 60676-54-2 | Molecular Weight | 352.34100 | |
| Density | 1.401g/cm3 | Boiling Point | 637.7ºC at 760 mmHg | |
| Molecular Formula | C19H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 339.4ºC | |
| Name | 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.401g/cm3 |
|---|---|
| Boiling Point | 637.7ºC at 760 mmHg |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.34100 |
| Flash Point | 339.4ºC |
| Exact Mass | 352.10600 |
| PSA | 103.78000 |
| LogP | 1.42350 |
| Index of Refraction | 1.639 |
| InChIKey | BAIZNEMAFFNNOX-UHFFFAOYSA-N |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)NC(Cc1ccccc1)C(=O)O |
| HS Code | 2925190090 |
|---|
|
~%
Phenylalanine,N... CAS#:60676-54-2 |
| Literature: Turner Journal of the American Chemical Society, 1953 , vol. 75, p. 2388 |
|
~%
Phenylalanine,N... CAS#:60676-54-2 |
| Literature: Boissonnas Helvetica Chimica Acta, 1951 , vol. 34, p. 874,878 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 262-370-1 |
| Phthaloylglycylphenylalanin |
| N-Phthalylglycyl-DL-phenylalanin |