Isothiazolo[3,4-d]pyrimidine-4,6(5H,7H)-dione,5,7-diethyl-3-(methylamino)- structure
|
Common Name | Isothiazolo[3,4-d]pyrimidine-4,6(5H,7H)-dione,5,7-diethyl-3-(methylamino)- | ||
|---|---|---|---|---|
| CAS Number | 60663-76-5 | Molecular Weight | 254.30900 | |
| Density | 1.347g/cm3 | Boiling Point | 358.1ºC at 760mmHg | |
| Molecular Formula | C10H14N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.4ºC | |
| Name | 5,7-diethyl-3-(methylamino)-[1,2]thiazolo[3,4-d]pyrimidine-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 358.1ºC at 760mmHg |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.30900 |
| Flash Point | 170.4ºC |
| Exact Mass | 254.08400 |
| PSA | 97.16000 |
| LogP | 0.77420 |
| Index of Refraction | 1.616 |
| InChIKey | AEOBTGVPGXANPC-UHFFFAOYSA-N |
| SMILES | CCn1c(=O)c2c(NC)snc2n(CC)c1=O |
|
~%
Isothiazolo[3,4... CAS#:60663-76-5 |
| Literature: Furukawa; Shima Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, # 5 p. 979 - 986 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 5,7-diethyl-3-methylamino-7H-isothiazolo[3,4-d]pyrimidine-4,6-dione |