4,4'-(3-Aminopropylidene)bisaniline
Modify Date: 2025-09-09 11:16:38
4,4'-(3-Aminopropylidene)bisaniline structure
|
Common Name | 4,4'-(3-Aminopropylidene)bisaniline | ||
|---|---|---|---|---|
| CAS Number | 6063-40-7 | Molecular Weight | 241.33100 | |
| Density | 1.157g/cm3 | Boiling Point | 454.6ºC at 760 mmHg | |
| Molecular Formula | C15H19N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256ºC | |
| Name | 4-[3-amino-3-(4-aminophenyl)propyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 454.6ºC at 760 mmHg |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.33100 |
| Flash Point | 256ºC |
| Exact Mass | 241.15800 |
| PSA | 78.06000 |
| LogP | 4.34630 |
| Index of Refraction | 1.659 |
| InChIKey | QAONFKCWKTUBRJ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(CCC(N)c2ccc(N)cc2)cc1 |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,3-Bis-(4-aminophenyl)-propylamine |
| TK 174 |
| ANILINE,4,4'-(3-AMINOPROPYLIDENE)DI |
| 3,3-Bis-<4-amino-phenyl>-propylamin |
| 1,1-Bis-(4-aminophenyl)-propyl-(3)-amin [German] |
| 1.1-Bis-(4-aminophenyl)-propyl-(3)-amin |