Trioxo(triphenylsilyloxy)rhenium(VII)
Modify Date: 2025-08-25 17:06:55
Trioxo(triphenylsilyloxy)rhenium(VII) structure
|
Common Name | Trioxo(triphenylsilyloxy)rhenium(VII) | ||
|---|---|---|---|---|
| CAS Number | 60624-60-4 | Molecular Weight | 510.61000 | |
| Density | N/A | Boiling Point | 388.6ºC at 760 mmHg | |
| Molecular Formula | C18H16O4ReSi | Melting Point | 108-110ºC | |
| MSDS | N/A | Flash Point | 188.8ºC | |
| Name | hydroxy(triphenyl)silane,trioxorhenium |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 388.6ºC at 760 mmHg |
|---|---|
| Melting Point | 108-110ºC |
| Molecular Formula | C18H16O4ReSi |
| Molecular Weight | 510.61000 |
| Flash Point | 188.8ºC |
| Exact Mass | 511.03800 |
| PSA | 20.23000 |
| LogP | 1.28940 |
| InChIKey | TVBZDHVJEWANCL-UHFFFAOYSA-N |
| SMILES | O=[Re](=O)=O.O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| Storage condition | 2-8℃ |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Trioxo(triphenylsilyloxy)rhenium(VII) |
| [O3ReOSiPh3] |
| triphenylsilyl perrhenate |
| <ReO3(OSiPh3)>(triphenylsiloxy)trioxorhenium(VII) |