4-Methoxymethylfentanyl
Modify Date: 2025-08-25 21:29:06
4-Methoxymethylfentanyl structure
|
Common Name | 4-Methoxymethylfentanyl | ||
|---|---|---|---|---|
| CAS Number | 60618-49-7 | Molecular Weight | 380.52300 | |
| Density | 1.081g/cm3 | Boiling Point | 492.1ºC at 760 mmHg | |
| Molecular Formula | C24H32N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.4ºC | |
| Name | N-[4-(methoxymethyl)-1-(2-phenylethyl)piperidin-4-yl]-N-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 492.1ºC at 760 mmHg |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.52300 |
| Flash Point | 251.4ºC |
| Exact Mass | 380.24600 |
| PSA | 32.78000 |
| LogP | 4.09120 |
| Index of Refraction | 1.565 |
| InChIKey | GARXJOUQUSNOGK-UHFFFAOYSA-N |
| SMILES | CCC(=O)N(c1ccccc1)C1(COC)CCN(CCc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2-Phenylethyl)-4-methoxymethyl-4-(N-propionylanilino)-piperidin |
| N-(4-(Methoxymethyl)-1-(2-phenylethyl)-4-piperidinyl)-N-phenylpropanamide |
| N-(4-methoxymethyl-1-phenethyl-piperidin-4-yl)-N-phenyl-propionamide |
| Propanamide,N-(4-(methoxymethyl)-1-(2-phenylethyl)-4-piperidinyl)-N-phenyl |
| 4-Methoxymethylfentanyl |
| R30490 |