1-(5-bromopyridin-3-yl)-2-tert-butyl-3-cyanoguanidine
Modify Date: 2025-10-26 08:53:07
1-(5-bromopyridin-3-yl)-2-tert-butyl-3-cyanoguanidine structure
|
Common Name | 1-(5-bromopyridin-3-yl)-2-tert-butyl-3-cyanoguanidine | ||
|---|---|---|---|---|
| CAS Number | 60560-09-0 | Molecular Weight | 296.16600 | |
| Density | 1.39g/cm3 | Boiling Point | 362.6ºC at 760 mmHg | |
| Molecular Formula | C11H14BrN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.1ºC | |
| Name | 1-(5-bromopyridin-3-yl)-2-tert-butyl-3-cyanoguanidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 362.6ºC at 760 mmHg |
| Molecular Formula | C11H14BrN5 |
| Molecular Weight | 296.16600 |
| Flash Point | 173.1ºC |
| Exact Mass | 295.04300 |
| PSA | 73.10000 |
| LogP | 2.94508 |
| Index of Refraction | 1.597 |
| InChIKey | IKQBUILEMPVYFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N=C(NC#N)Nc1cncc(Br)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| GUANIDINE,3-(5-BROMO-3-PYRIDYL)-1-tert-BUTYL-2-CYANO |
| 3-(5-Bromo-3-pyridyl)-1-tert-butyl-2-cyanoguanidine |
| 3-(5-BROMO-PYRIDIN-3-YL)-1-TERT-BUTYL-2-CYANOGUANIDINE |
| N-(5-bromo-pyridin-3-yl)-N'-tert-butyl-N''-cyano-guanidine |