H-Met-Trp-OH
Modify Date: 2025-08-20 14:41:33
H-Met-Trp-OH structure
|
Common Name | H-Met-Trp-OH | ||
|---|---|---|---|---|
| CAS Number | 60535-02-6 | Molecular Weight | 335.42100 | |
| Density | 1.327g/cm3 | Boiling Point | 667.9ºC at 760 mmHg | |
| Molecular Formula | C16H21N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 357.7ºC | |
| Name | Met-Trp |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 667.9ºC at 760 mmHg |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.42100 |
| Flash Point | 357.7ºC |
| Exact Mass | 335.13000 |
| PSA | 133.51000 |
| LogP | 2.45140 |
| Index of Refraction | 1.653 |
| InChIKey | XYVRXLDSCKEYES-JSGCOSHPSA-N |
| SMILES | CSCCC(N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| HS Code | 2933990090 |
|---|
|
~%
H-Met-Trp-OH CAS#:60535-02-6 |
| Literature: Usuki, Hirokazu; Yamamoto, Yukihiro; Arima, Jiro; Iwabuchi, Masaki; Miyoshi, Shozo; Nitoda, Teruhiko; Hatanaka, Tadashi Organic and Biomolecular Chemistry, 2011 , vol. 9, # 7 p. 2327 - 2335 |
|
~%
H-Met-Trp-OH CAS#:60535-02-6 |
| Literature: Senoo, Akihiro; Tabata, Kazuhiko; Yonetani, Yoshiyuki; Yagasaki, Makoto Bioscience, Biotechnology and Biochemistry, 2010 , vol. 74, # 2 p. 415 - 418 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| L-Tryptophan,N-L-methionyl |
| L-Methionyl-L-tryptophan |
| (2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| Methionyltryptophan |
| N-L-methionyl-L-tryptophan |
| L-Met-L-Trp |
| Met-trp |