tert-Butyl ((1H-indol-3-yl)methyl)carbamate
Modify Date: 2025-08-25 19:29:01
tert-Butyl ((1H-indol-3-yl)methyl)carbamate structure
|
Common Name | tert-Butyl ((1H-indol-3-yl)methyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 60524-00-7 | Molecular Weight | 246.305 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 437.0±28.0 °C at 760 mmHg | |
| Molecular Formula | C14H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.1±24.0 °C | |
| Name | tert-Butyl ((1H-indol-3-yl)methyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 437.0±28.0 °C at 760 mmHg |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.305 |
| Flash Point | 218.1±24.0 °C |
| Exact Mass | 246.136826 |
| PSA | 54.12000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | VEHKDBGCOVLARX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCc1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl N-(1H-indol-3-ylmethyl)carbamate |
| 2-Methyl-2-propanyl (1H-indol-3-ylmethyl)carbamate |
| Carbamic acid, N-(1H-indol-3-ylmethyl)-, 1,1-dimethylethyl ester |