H-Aib-OBzl structure
|
Common Name | H-Aib-OBzl | ||
|---|---|---|---|---|
| CAS Number | 60421-20-7 | Molecular Weight | 229.70300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16ClNO2 | Melting Point | 170-171℃ | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | benzyl 2-amino-2-methylpropanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 170-171℃ |
|---|---|
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.70300 |
| Exact Mass | 229.08700 |
| PSA | 52.32000 |
| LogP | 2.96940 |
| InChIKey | OXUUEIDXKLFLER-UHFFFAOYSA-N |
| SMILES | CC(C)(N)C(=O)OCc1ccccc1.Cl |
| Storage condition | 2-8°C |
| Water Solubility | H2O: soluble50mg/mL, clear, colorless |
| RIDADR | NONH for all modes of transport |
|---|
|
~59%
H-Aib-OBzl CAS#:60421-20-7 |
| Literature: VALEANT RESEARCH and DEVELOPMENT Patent: WO2006/121820 A1, 2006 ; Location in patent: Page/Page column 15-16 ; |
|
~%
H-Aib-OBzl CAS#:60421-20-7 |
| Literature: Kissei Pharmaceutical Co., Ltd. Patent: EP1544208 A1, 2005 ; Location in patent: Page/Page column 62-63 ; |
|
~60%
H-Aib-OBzl CAS#:60421-20-7 |
| Literature: Roche Palo Alto LLC Patent: US2007/42988 A1, 2007 ; Location in patent: Page/Page column 18; 21 ; |
| benzyl-2-amino-2-methylpropanoate hydrochloride salt |
| 2-aminoisobutyrate benzyl ester hydrochloride |
| Benzyl |A-aminoisobutyrate hydrochloride |
| Benzyl 2-amino-2-methylpropionate hydrochloride |
| benzyl 2-aminoisobutyryl hydrochloride |
| benzyl 2-amino-2-methylpropanoate hydrochloride |
| H-Aib-OBzl |
| 2-Methylalanine benzyl ester hydrochloride |
| H-Aib-OBn*HCl |
| 2-amino-2-methyl-propionic acid benzyl ester hydrochloride |