(1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one
![(1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one Structure](https://image.chemsrc.com/caspic/456/60362-44-9.png)
(1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one structure
|
Common Name | (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 60362-44-9 | Molecular Weight | 206.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22O |
|---|---|
| Molecular Weight | 206.32400 |
| Exact Mass | 206.16700 |
| PSA | 17.07000 |
| LogP | 3.73810 |
| InChIKey | MBZBBVTYLUNZPJ-YHYXMXQVSA-N |
| SMILES | CC1=CCCC(=O)C2CC(C)(C)C2CC1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:87-44-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| β-caryophyllene ketone |
| nor-Caryophyllene ketone |
| (E)-15-norcaryophyll-4-en-8-one |
| 12-Norcaryophyll-6-en-3-on |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 60362-44-9? |
| A: Chinese name of 60362-44-9 is 60362-44-9. |
| Q: What are the downstream products of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one? |
| A: Related downstream products(CAS) of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one: 87-44-5. |
| Q: What is the polar surface area (PSA) of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one? |
| A: Polar surface area (PSA) of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one is 17.07000. |
| Q: What is the English name of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one? |
| A: The English name of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one is (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one. |
| Q: What is the InChIKey of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one? |
| A: InChIKey of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one is MBZBBVTYLUNZPJ-YHYXMXQVSA-N. |
| Q: What English synonyms does (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one have? |
| A: English synonyms of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one: β-caryophyllene ketone, nor-Caryophyllene ketone, (E)-15-norcaryophyll-4-en-8-one, 12-Norcaryophyll-6-en-3-on. |
| Q: What is the CAS number of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one? |
| A: CAS number of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one is 60362-44-9. |
| Q: What is the molecular weight of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one? |
| A: Molecular weight of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one is 206.32400. |
| Q: What is the SMILES notation of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one? |
| A: SMILES notation of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one is CC1=CCCC(=O)C2CC(C)(C)C2CC1. |
| Q: What is the LogP of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one? |
| A: LogP of (1S,9R)-6,10,10-trimethylbicyclo[7.2.0]undec-(5E)-en-2-one is 3.73810. |