4-chloro-1-(cyclopropylmethylsulfanyl)-2-nitrobenzene
Modify Date: 2024-09-29 15:28:21
4-chloro-1-(cyclopropylmethylsulfanyl)-2-nitrobenzene structure
|
Common Name | 4-chloro-1-(cyclopropylmethylsulfanyl)-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 60340-91-2 | Molecular Weight | 243.71000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-1-(cyclopropylmethylsulfanyl)-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10ClNO2S |
|---|---|
| Molecular Weight | 243.71000 |
| Exact Mass | 243.01200 |
| PSA | 71.12000 |
| LogP | 4.27350 |
| InChIKey | FGGNCCIBCGZHEX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1SCC1CC1 |
|
~%
4-chloro-1-(cyc... CAS#:60340-91-2 |
| Literature: The Procter and Gamble Company Patent: US3959324 A1, 1976 ; |
| Benzene,4-chloro-1-[(cyclopropylmethyl)thio]-2-nitro |
| cyclopropylcarbinyl 2-nitro-4-chlorophenyl sulfide |