4-[[2-[(2-chlorobenzoyl)amino]benzoyl]amino]benzoic acid structure
|
Common Name | 4-[[2-[(2-chlorobenzoyl)amino]benzoyl]amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 6033-73-4 | Molecular Weight | 394.80800 | |
| Density | 1.453g/cm3 | Boiling Point | 483.6ºC at 760mmHg | |
| Molecular Formula | C21H15ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.3ºC | |
| Name | 4-[[2-[(2-chlorobenzoyl)amino]benzoyl]amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 483.6ºC at 760mmHg |
| Molecular Formula | C21H15ClN2O4 |
| Molecular Weight | 394.80800 |
| Flash Point | 246.3ºC |
| Exact Mass | 394.07200 |
| PSA | 98.99000 |
| LogP | 4.99980 |
| Index of Refraction | 1.719 |
| InChIKey | HMSKCPQZCPNPSC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NC(=O)c2ccccc2NC(=O)c2ccccc2Cl)cc1 |
|
~%
4-[[2-[(2-chlor... CAS#:6033-73-4 |
| Literature: Manske Canadian Journal of Research, 1933 , vol. 9, p. 436,441 |
| 4-({2-[(2-chlorobenzoyl)amino]benzoyl}amino)benzoic acid |