6-chloro-3-phenylpyridazin-4-ol, compound with ethylamine (1:1) structure
|
Common Name | 6-chloro-3-phenylpyridazin-4-ol, compound with ethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 60329-37-5 | Molecular Weight | 251.71200 | |
| Density | N/A | Boiling Point | 315.3ºC at 760 mmHg | |
| Molecular Formula | C12H14ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.5ºC | |
| Name | 6-chloro-3-phenyl-1H-pyridazin-4-one,ethanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 315.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H14ClN3O |
| Molecular Weight | 251.71200 |
| Flash Point | 144.5ºC |
| Exact Mass | 251.08300 |
| PSA | 72.03000 |
| LogP | 3.16790 |
| InChIKey | UYGCJCVDGZTXOK-UHFFFAOYSA-N |
| SMILES | CCN.O=c1cc(Cl)[nH]nc1-c1ccccc1 |
| 6-Chloro-3-phenylpyridazin-4-ol,compound with ethylamine (1:1) |
| EINECS 262-179-3 |