1,8-bis(methylamino)anthraquinone
1,8-bis(methylamino)anthraquinone structure
|
Common Name | 1,8-bis(methylamino)anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 60316-43-0 | Molecular Weight | 266.29500 | |
| Density | 1.345g/cm3 | Boiling Point | 528ºC at 760 mmHg | |
| Molecular Formula | C16H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214ºC | |
| Name | 1,8-bis(methylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.345g/cm3 |
|---|---|
| Boiling Point | 528ºC at 760 mmHg |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.29500 |
| Flash Point | 214ºC |
| Exact Mass | 266.10600 |
| PSA | 58.20000 |
| LogP | 2.69140 |
| Index of Refraction | 1.716 |
| InChIKey | WBNXSOGPMIRTPK-UHFFFAOYSA-N |
| SMILES | CNc1cccc2c1C(=O)c1c(NC)cccc1C2=O |
| HS Code | 2922399090 |
|---|
|
~92%
1,8-bis(methyla... CAS#:60316-43-0 |
| Literature: Ciba-Geigy Corporation Patent: US4044030 A1, 1977 ; |
|
~%
1,8-bis(methyla... CAS#:60316-43-0 |
| Literature: Bayer and Co. Patent: DE144634 ; |
|
~%
1,8-bis(methyla... CAS#:60316-43-0 |
| Literature: Bayer and Co. Patent: DE165728 ; |
|
~%
1,8-bis(methyla... CAS#:60316-43-0 |
| Literature: Bayer and Co. Patent: DE156056 ; |
|
~%
1,8-bis(methyla... CAS#:60316-43-0 |
| Literature: Bayer and Co. Patent: DE144634 ; |
|
~%
1,8-bis(methyla... CAS#:60316-43-0 |
| Literature: Bayer and Co. Patent: DE144634 ; |
|
~%
1,8-bis(methyla... CAS#:60316-43-0 |
| Literature: Bayer and Co. Patent: DE164293 ; |
|
~%
1,8-bis(methyla... CAS#:60316-43-0 |
| Literature: Bayer and Co. Patent: DE165728 ; |
|
~%
1,8-bis(methyla... CAS#:60316-43-0 |
| Literature: Bayer and Co. Patent: DE164293 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 8, p. 235 Full Text Show Details Schmidt,R. E. Chemische Berichte, 1904 , vol. 37, p. 72 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 9,10-Anthracenedione,1,8-bis(methylamino) |
| 1,8-bis-methylaminoanthraquinone |
| 1,8-Bis-methylamino-anthrachinon |
| EINECS 262-167-8 |
| 1,8-Bis(methylamino)-9,10-anthracenedione |
| 1,8-dimethylaminoanthraquinone |
| 1,8-Dimethylamino-9,10-anthraquinone |