Phenol,2-[(1,3-benzodioxol-5-ylmethylene)amino]- structure
|
Common Name | Phenol,2-[(1,3-benzodioxol-5-ylmethylene)amino]- | ||
|---|---|---|---|---|
| CAS Number | 60301-57-7 | Molecular Weight | 241.24200 | |
| Density | 1.28g/cm3 | Boiling Point | 436.1ºC at 760mmHg | |
| Molecular Formula | C14H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.6ºC | |
| Name | 2-(1,3-benzodioxol-5-ylmethylideneamino)phenol |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 436.1ºC at 760mmHg |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.24200 |
| Flash Point | 217.6ºC |
| Exact Mass | 241.07400 |
| PSA | 51.05000 |
| LogP | 2.87150 |
| Index of Refraction | 1.623 |
| InChIKey | BQRPHDGQSWTHRV-UHFFFAOYSA-N |
| SMILES | Oc1ccccc1N=Cc1ccc2c(c1)OCO2 |
|
~%
Phenol,2-[(1,3-... CAS#:60301-57-7 |
| Literature: Stephens; Bower Journal of the Chemical Society, 1949 , p. 2971 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |