Hydrazinecarboxylicacid, 2-[4-(1,1-dimethylethyl)cyclohexylidene]-, 1,1-dimethylethyl ester structure
|
Common Name | Hydrazinecarboxylicacid, 2-[4-(1,1-dimethylethyl)cyclohexylidene]-, 1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 60295-14-9 | Molecular Weight | 268.39500 | |
| Density | 1.01g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H28N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-[(4-tert-butylcyclohexylidene)amino]carbamate |
|---|
| Density | 1.01g/cm3 |
|---|---|
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.39500 |
| Exact Mass | 268.21500 |
| PSA | 50.69000 |
| LogP | 4.49430 |
| Index of Refraction | 1.497 |
| InChIKey | SDEIMMNFUISAGU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NN=C1CCC(C(C)(C)C)CC1 |
|
~%
Hydrazinecarbox... CAS#:60295-14-9 |
| Literature: Baumgarten,H.E. et al. Journal of Organic Chemistry, 1976 , vol. 41, p. 3805 - 3811 |
|
~%
Hydrazinecarbox... CAS#:60295-14-9 |
| Literature: SMITHKLINE BEECHAM CORPORATION Patent: WO2003/103686 A1, 2003 ; Location in patent: Page 31, 32 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |