2,6-ditert-butyl-4-[[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]piperazin-1-yl]methyl]phenol structure
|
Common Name | 2,6-ditert-butyl-4-[[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]piperazin-1-yl]methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 6029-54-5 | Molecular Weight | 522.80500 | |
| Density | 1.027g/cm3 | Boiling Point | 546.1ºC at 760 mmHg | |
| Molecular Formula | C34H54N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5ºC | |
| Name | 2,6-ditert-butyl-4-[[4-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]piperazin-1-yl]methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.027g/cm3 |
|---|---|
| Boiling Point | 546.1ºC at 760 mmHg |
| Molecular Formula | C34H54N2O2 |
| Molecular Weight | 522.80500 |
| Flash Point | 207.5ºC |
| Exact Mass | 522.41900 |
| PSA | 46.94000 |
| LogP | 7.48140 |
| Index of Refraction | 1.546 |
| InChIKey | BBGJFAYGMNGEIW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CN2CCN(Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)CC2)cc(C(C)(C)C)c1O |
|
~89%
2,6-ditert-buty... CAS#:6029-54-5 |
| Literature: Bukharov; Nugumanova; Mukmeneva Russian Journal of General Chemistry, 1998 , vol. 68, # 10 p. 1605 - 1608 |
| N,N-bis(3,5-di-tert-butyl-4-hydroxybenzyl)piperazine |
| Fenol 85 |
| Phenol,4,4'-(1,4-piperazinediylbis(methylene))bis(2,6-bis(1,1-dimethylethyl) |
| 4,4'-(1,4-Piperazinediylbis(methylene))bis(2,6-bis(1,1-dimethylethyl)phenol) |
| Phenol 85 |
| 2,6,2',6'-tetra-tert-butyl-4,4'-piperazine-1,4-diyldimethyl-bis-phenol |