ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane,2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane structure
|
Common Name | ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane,2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane | ||
|---|---|---|---|---|
| CAS Number | 60162-06-3 | Molecular Weight | 483.01500 | |
| Density | N/A | Boiling Point | 175ºC at 760 mmHg | |
| Molecular Formula | C16H42O5Si6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 63.2ºC | |
| Name | ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane,2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 175ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H42O5Si6 |
| Molecular Weight | 483.01500 |
| Flash Point | 63.2ºC |
| Exact Mass | 482.16500 |
| PSA | 46.15000 |
| LogP | 5.73720 |
| InChIKey | OMHXNOYYZVLVEU-UHFFFAOYSA-N |
| SMILES | C=C[Si](C)(C)O[Si](C)(C)C=C.C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| Cyclotetrasiloxane,2,2,4,4,6,6,8,8-octamethyl-,polymer with 1,3-diethenyl-1,1,3,3-tetramethyldisiloxane |
| Cyclotetrasiloxane,octamethyl-,polymer with 1,3-diethenyl-1,1,3,3-tetramethyldisiloxane |