4,5-dihydro-1-phenyl-3-(2,4,6-trimethylphenyl)-1H-pyrazole
Modify Date: 2025-09-10 16:34:56
4,5-dihydro-1-phenyl-3-(2,4,6-trimethylphenyl)-1H-pyrazole structure
|
Common Name | 4,5-dihydro-1-phenyl-3-(2,4,6-trimethylphenyl)-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 60078-97-9 | Molecular Weight | 264.36500 | |
| Density | 1.05g/cm3 | Boiling Point | 397.2ºC at 760 mmHg | |
| Molecular Formula | C18H20N2 | Melting Point | 97 °C | |
| MSDS | N/A | Flash Point | 194ºC | |
| Name | 2-phenyl-5-(2,4,6-trimethylphenyl)-3,4-dihydropyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 397.2ºC at 760 mmHg |
| Melting Point | 97 °C |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.36500 |
| Flash Point | 194ºC |
| Exact Mass | 264.16300 |
| PSA | 15.60000 |
| LogP | 3.72680 |
| Index of Refraction | 1.59 |
| InChIKey | BJEAUUFMQKUXAX-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C2=NN(c3ccccc3)CC2)c(C)c1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Phenyl-3-(2,4,6-trimethylphenyl)-2-pyrazoline |
| 4,5-Dihydro-1-phenyl-3-(2,4,6-trimethylphenyl)-1H-pyrazole |
| 3-mesityl-1-phenyl-4,5-dihydro-1h-pyrazole |
| EINECS 262-048-0 |