2-(2,3-dihydro-1,3-dioxo-1H-inden-2-yl)-8-methylquinoline-6-sulphonic acid, compound with 2,2',2''-nitrilotriethanol (1:1) structure
|
Common Name | 2-(2,3-dihydro-1,3-dioxo-1H-inden-2-yl)-8-methylquinoline-6-sulphonic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 60077-41-0 | Molecular Weight | 516.56300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28N2O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,2-(1,3-dioxoinden-2-yl)-8-methylquinoline-6-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H28N2O8S |
|---|---|
| Molecular Weight | 516.56300 |
| Exact Mass | 516.15700 |
| PSA | 173.71000 |
| LogP | 2.29880 |
| InChIKey | KWSNCEDKVLBJOD-UHFFFAOYSA-N |
| SMILES | Cc1cc(S(=O)(=O)O)cc2ccc(C3C(=O)c4ccccc4C3=O)nc12.OCCN(CCO)CCO |
| 2-(2,3-Dihydro-1,3-dioxo-1H-inden-2-yl)-8-methylquinoline-6-sulphonic acid,compound with 2,2',2''-nitrilotriethanol (1:1) |
| EINECS 262-045-4 |
| 2-(1,3-dioxoinden-2-yl)-8-methylquinoline-6-sulfonic acid |