4-(1,3-dioxolan-2-yl)butan-2-yl-triphenylphosphanium,iodide structure
|
Common Name | 4-(1,3-dioxolan-2-yl)butan-2-yl-triphenylphosphanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 60066-86-6 | Molecular Weight | 518.36700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28IO2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(1,3-dioxolan-2-yl)butan-2-yl-triphenylphosphanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H28IO2P |
|---|---|
| Molecular Weight | 518.36700 |
| Exact Mass | 518.08700 |
| PSA | 32.05000 |
| LogP | 1.52610 |
| InChIKey | QUGAGKQLOIEQJW-UHFFFAOYSA-M |
| SMILES | CC(CCC1OCCO1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
|
~%
4-(1,3-dioxolan... CAS#:60066-86-6 |
| Literature: Crombie, Leslie; Kneen, Geoffrey; Pattenden, Gerald; Whybrow, Derek Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1711 - 1717 |
| Phosphonium,[3-(1,3-dioxolan-2-yl)-1-methylpropyl]triphenyl-,iodide |