benzyl 3,3-dimethylpent-4-enoate structure
|
Common Name | benzyl 3,3-dimethylpent-4-enoate | ||
|---|---|---|---|---|
| CAS Number | 60066-73-1 | Molecular Weight | 218.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl 3,3-dimethylpent-4-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O2 |
|---|---|
| Molecular Weight | 218.29200 |
| Exact Mass | 218.13100 |
| PSA | 26.30000 |
| LogP | 3.33210 |
| InChIKey | KTTWBXNQECIUKC-UHFFFAOYSA-N |
| SMILES | C=CC(C)(C)CC(=O)OCc1ccccc1 |
|
~63%
benzyl 3,3-dime... CAS#:60066-73-1 |
| Literature: Sagami Chemical Research Center Patent: US4214097 A1, 1980 ; |
|
~78%
benzyl 3,3-dime... CAS#:60066-73-1 |
| Literature: Murakami; Itahashi; Amii; Takahashi; Ito Journal of the American Chemical Society, 1998 , vol. 120, # 38 p. 9949 - 9950 |
| 4-Pentenoic acid,3,3-dimethyl-,phenylmethyl ester |
| 3,3-Dimethyl-4-pentensaeure-benzylester |
| benzyl 3,3-dimethyl-4-pentenoate |