4-(benzenesulfonyl)benzene-1,2-diol
Modify Date: 2025-11-26 09:51:01
4-(benzenesulfonyl)benzene-1,2-diol structure
|
Common Name | 4-(benzenesulfonyl)benzene-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 60048-84-2 | Molecular Weight | 250.27000 | |
| Density | 1.432g/cm3 | Boiling Point | 500.5ºC at 760 mmHg | |
| Molecular Formula | C12H10O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.5ºC | |
| Name | 4-(benzenesulfonyl)benzene-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.432g/cm3 |
|---|---|
| Boiling Point | 500.5ºC at 760 mmHg |
| Molecular Formula | C12H10O4S |
| Molecular Weight | 250.27000 |
| Flash Point | 256.5ºC |
| Exact Mass | 250.03000 |
| PSA | 82.98000 |
| LogP | 3.01140 |
| Index of Refraction | 1.645 |
| InChIKey | ASZNFGAKSIUZLU-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(O)c(O)c1 |
|
~93%
4-(benzenesulfo... CAS#:60048-84-2 |
| Literature: Nematollahi; Habibi; Alizadeh Phosphorus, Sulfur and Silicon and the Related Elements, 2006 , vol. 181, # 6 p. 1391 - 1396 |
| 4-benzenesulfonyl-pyrocatechol |
| 4-(PHENYLSULFONYL)CATECHOL |
| 4-Benzolsulfonyl-brenzcatechin |
| 4-Phenylsulfonylpyrocatechol |