2,2',4,5'-Tetrabromobiphenyl structure
|
Common Name | 2,2',4,5'-Tetrabromobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 60044-24-8 | Molecular Weight | 469.792 | |
| Density | 2.1±0.1 g/cm3 | Boiling Point | 405.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H6Br4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.7±22.1 °C | |
| Name | 2,2',4,5'-Tetrabromobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 2.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 405.3±40.0 °C at 760 mmHg |
| Molecular Formula | C12H6Br4 |
| Molecular Weight | 469.792 |
| Flash Point | 192.7±22.1 °C |
| Exact Mass | 465.720276 |
| LogP | 6.68 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | LUASYBWZXWTYKK-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2cc(Br)ccc2Br)c(Br)c1 |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1'-Biphenyl, 2,2',4,5'-tetrabromo- |
| Biphenyl, 2,2',4',5-tetrabromo- |
| 1,4-dibromo-2-(2,4-dibromophenyl)benzene |
| 2,2',4,5'-Tetrabromo-1,1'-biphenyl |
| 2,2',4,5'-Tetrabromobiphenyl |