dimevamide
Modify Date: 2025-08-30 18:10:58
dimevamide structure
|
Common Name | dimevamide | ||
|---|---|---|---|---|
| CAS Number | 60-46-8 | Molecular Weight | 296.40700 | |
| Density | 1.069g/cm3 | Boiling Point | 467.7ºC at 760 mmHg | |
| Molecular Formula | C19H24N2O | Melting Point | 137ºC | |
| MSDS | N/A | Flash Point | 236.6ºC | |
| Name | aminopentamide sulfate (200 mg) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.069g/cm3 |
|---|---|
| Boiling Point | 467.7ºC at 760 mmHg |
| Melting Point | 137ºC |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.40700 |
| Flash Point | 236.6ºC |
| Exact Mass | 296.18900 |
| PSA | 46.33000 |
| LogP | 3.49850 |
| Index of Refraction | 1.564 |
| InChIKey | NARHAGIVSFTMIG-UHFFFAOYSA-N |
| SMILES | CC(CC(C(N)=O)(c1ccccc1)c1ccccc1)N(C)C |
| HS Code | 2924299090 |
|---|
|
~%
dimevamide CAS#:60-46-8 |
| Literature: Journal of the Chemical Society, , p. 648,651 |
![Benzeneacetic acid, a-[2-(dimethylamino)propyl]-a-phenyl- structure](https://image.chemsrc.com/caspic/408/5348-94-7.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| BL-139 |
| Valeramide-OM |
| Centrine |
| 4-dimethylamino-2,2-diphenyl-valeric acid amide |
| (+-)-4-Dimethylamino-2.2-diphenyl-valeramid |
| 4-(dimethylamino)-2,2-di(phenyl)pentanamide |
| 4-Dimethylamino-2,2-diphenylva-leramide |
| dimevamide |
| (+-)-4-Dimethylamino-2,2-diphenyl-valeriansaeure-amid |
| Aminopentamide |
| AMINOPENTAMIDE SULFATE |