2,5-Cyclohexadiene-1,4-dione,2,5-bis(1-aziridinyl)-3-fluoro-6-(4-morpholinyl)- structure
|
Common Name | 2,5-Cyclohexadiene-1,4-dione,2,5-bis(1-aziridinyl)-3-fluoro-6-(4-morpholinyl)- | ||
|---|---|---|---|---|
| CAS Number | 59886-45-2 | Molecular Weight | 293.29400 | |
| Density | 1.5g/cm3 | Boiling Point | 404.5ºC at 760mmHg | |
| Molecular Formula | C14H16FN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.4ºC | |
| Name | 2,5-bis(aziridin-1-yl)-3-fluoro-6-morpholin-4-ylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 404.5ºC at 760mmHg |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.29400 |
| Flash Point | 198.4ºC |
| Exact Mass | 293.11800 |
| PSA | 52.63000 |
| Index of Refraction | 1.651 |
| InChIKey | ZLYFLISWTUFTOE-UHFFFAOYSA-N |
| SMILES | O=C1C(F)=C(N2CC2)C(=O)C(N2CCOCC2)=C1N1CC1 |
|
~%
2,5-Cyclohexadi... CAS#:59886-45-2 |
| Literature: Chou; Khan; Driscoll Journal of Medicinal Chemistry, 1976 , vol. 19, # 11 p. 1302 - 1308 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-dione,2,5-bis(1-aziridinyl)-3-fluoro-6-(4-morpholinyl) |
| 2,5-bis-aziridin-1-yl-3-fluoro-6-morpholin-4-yl-[1,4]benzoquinone |