1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine
Modify Date: 2025-09-09 20:22:35
1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine structure
|
Common Name | 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine | ||
|---|---|---|---|---|
| CAS Number | 59872-85-4 | Molecular Weight | 242.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9F3N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9F3N4 |
|---|---|
| Molecular Weight | 242.20 |
| InChIKey | KXUHKIHBWDBCBR-UHFFFAOYSA-N |
| SMILES | CN1NC(c2ccccc2)=NN=C1C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine? |
| A: InChIKey of 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine is KXUHKIHBWDBCBR-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 59872-85-4? |
| A: Chinese name of 59872-85-4 is 59872-85-4. |
| Q: What is the English name of 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine? |
| A: The English name of 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine is 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine. |
| Q: What is the CAS number of 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine? |
| A: CAS number of 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine is 59872-85-4. |
| Q: What is the molecular weight of 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine? |
| A: Molecular weight of 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine is 242.20. |
| Q: What is the molecular formula of 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine? |
| A: Molecular formula of 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine is C10H9F3N4. |
| Q: What is the SMILES notation of 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine? |
| A: SMILES notation of 1,2-Dihydro-1-methyl-3-phenyl-6-(trifluoromethyl)-1,2,4,5-tetrazine is CN1NC(c2ccccc2)=NN=C1C(F)(F)F. |