5-(4-BROMOPHENYL)-2,4-DIHYDRO-2-PHENYL-3H-PYRAZOL-3-ONE structure
|
Common Name | 5-(4-BROMOPHENYL)-2,4-DIHYDRO-2-PHENYL-3H-PYRAZOL-3-ONE | ||
|---|---|---|---|---|
| CAS Number | 59848-48-5 | Molecular Weight | 315.16500 | |
| Density | 1.47g/cm3 | Boiling Point | 408ºC at 760 mmHg | |
| Molecular Formula | C15H11BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.6ºC | |
| Name | 5-(4-bromophenyl)-2-phenyl-4H-pyrazol-3-one |
|---|
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 408ºC at 760 mmHg |
| Molecular Formula | C15H11BrN2O |
| Molecular Weight | 315.16500 |
| Flash Point | 200.6ºC |
| Exact Mass | 314.00500 |
| PSA | 32.67000 |
| LogP | 3.09070 |
| Index of Refraction | 1.665 |
| InChIKey | QQPLABDBDDLNLI-UHFFFAOYSA-N |
| SMILES | O=C1CC(c2ccc(Br)cc2)=NN1c1ccccc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |