dimethyl 1-ethyl-9H-carbazole-2,3-dicarboxylate structure
|
Common Name | dimethyl 1-ethyl-9H-carbazole-2,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 59774-13-9 | Molecular Weight | 311.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 1-ethyl-9H-carbazole-2,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H17NO4 |
|---|---|
| Molecular Weight | 311.33200 |
| Exact Mass | 311.11600 |
| PSA | 68.39000 |
| LogP | 3.45670 |
| InChIKey | COFYCOKKWZVUDC-UHFFFAOYSA-N |
| SMILES | CCc1c(C(=O)OC)c(C(=O)OC)cc2c1[nH]c1ccccc12 |
|
~55%
dimethyl 1-ethy... CAS#:59774-13-9 |
| Literature: Moody, Christopher J.; Shah, Pritom Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 1407 - 1416 |
| diester methylique de l'acide ethyl-1 carbazoledicarboxylique-2,3 |
| 1-Ethyl-carbazol-dicarbonsaeure-(2,3)-dimethylester |
| 1-ethyl-carbazole-2,3-dicarboxylic acid dimethyl ester |
| 9H-ethyl-1 carbazole dicarboxylate de methyle-2,3 |
| 9H-Carbazole-2,3-dicarboxylic acid,1-ethyl-,dimethyl ester |