2,6-dinitro-N-pentan-3-yl-4-(trifluoromethyl)aniline structure
|
Common Name | 2,6-dinitro-N-pentan-3-yl-4-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 5973-53-5 | Molecular Weight | 321.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14F3N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dinitro-N-pentan-3-yl-4-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14F3N3O4 |
|---|---|
| Molecular Weight | 321.25200 |
| Exact Mass | 321.09400 |
| PSA | 103.67000 |
| LogP | 5.24170 |
| InChIKey | UASSGOXNPFOKPH-UHFFFAOYSA-N |
| SMILES | CCC(CC)Nc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| HS Code | 2921420090 |
|---|
|
~68%
2,6-dinitro-N-p... CAS#:5973-53-5 |
| Literature: Benbow, John W.; Bernberg, Erin L.; Korda, Anna; Mead, Jan R. Antimicrobial Agents and Chemotherapy, 1998 , vol. 42, # 2 p. 339 - 343 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenamine,N-(1-ethylpropyl)-2,6-dinitro-4-(trifluoromethyl) |
| N-(3-pentyl)-2,6-dinitro-4-trifluoromethylaniline |
| N-(3-pentyl)-4-trifluoromethyl-2,6-dinitroaniline |
| 4-Trifluoromethyl-2,6-dinitro-N-3-pentylanilin |
| (Dinitro-trifluoromethyl-phenyl)-(1-ethyl-propyl)-amine |