1-(2,3,4,5,6-pentafluorophenyl)pyrrole-2,5-dione structure
|
Common Name | 1-(2,3,4,5,6-pentafluorophenyl)pyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 59726-65-7 | Molecular Weight | 263.12000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H2F5NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,3,4,5,6-pentafluorophenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H2F5NO2 |
|---|---|
| Molecular Weight | 263.12000 |
| Exact Mass | 263.00100 |
| PSA | 37.38000 |
| LogP | 1.87650 |
| InChIKey | UWORINMKYBTGFK-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1c(F)c(F)c(F)c(F)c1F |
|
~72%
1-(2,3,4,5,6-pe... CAS#:59726-65-7 |
| Literature: Facchetti, Antonio; Marks, Tobin J.; Wang, Zhiming M. Patent: US2008/185555 A1, 2008 ; Location in patent: Page/Page column 12 ; |
|
~%
1-(2,3,4,5,6-pe... CAS#:59726-65-7 |
| Literature: Choi, Jongwan; Oh, Jin-Woo; Kim, Nakjoong Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 4 p. 1077 - 1080 |
| N-pentafluorophenylmaleimide |
| 1-(2,3,4,5,6-pentafluorophenyl)azoline-2,5-dione |
| N-2,3,4,5,6-(pentafluorophenyl)maleimide |
| pentafluorophenylmaleimide |
| 1-(perfluorophenyl)-1H-pyrrole-2,5-dione |
| 1-Pentafluorophenyl-pyrrole-2,5-dione |