4-Ethoxy-3-nitrobenzoic acid
Modify Date: 2025-08-30 16:29:22
4-Ethoxy-3-nitrobenzoic acid structure
|
Common Name | 4-Ethoxy-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 59719-77-6 | Molecular Weight | 211.17100 | |
| Density | 1.368 g/cm3 | Boiling Point | 378.6ºC at 760 mmHg | |
| Molecular Formula | C9H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Ethoxy-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.368 g/cm3 |
|---|---|
| Boiling Point | 378.6ºC at 760 mmHg |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17100 |
| Exact Mass | 211.04800 |
| PSA | 92.35000 |
| LogP | 2.21490 |
| Index of Refraction | 1.575 |
| InChIKey | GZHXYRWGRKIXEJ-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)O)cc1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Aethoxy-3-nitro-benzoesaeure |
| 4-Ethoxy-3-nitro-benzoic acid |