Ethyl 7-amino-5-chloro-1H-indole-2-carboxylate
Modify Date: 2025-08-24 20:52:40
Ethyl 7-amino-5-chloro-1H-indole-2-carboxylate structure
|
Common Name | Ethyl 7-amino-5-chloro-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 59694-51-8 | Molecular Weight | 238.670 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 454.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.8±27.3 °C | |
| Name | ethyl 7-amino-5-chloro-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 454.7±40.0 °C at 760 mmHg |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.670 |
| Flash Point | 228.8±27.3 °C |
| Exact Mass | 238.050903 |
| PSA | 68.11000 |
| LogP | 2.89 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | PIHIUNXBMGLYRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2cc(Cl)cc(N)c2[nH]1 |
|
~84%
Ethyl 7-amino-5... CAS#:59694-51-8 |
| Literature: Katti, H. A.; Siddappa, S. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 12 p. 1205 - 1208 |
| 1H-Indole-2-carboxylic acid, 7-amino-5-chloro-, ethyl ester |
| 1H-Indole-2-carboxylic acid,7-amino-5-chloro-,ethyl ester |
| Ethyl 7-amino-5-chloro-1H-indole-2-carboxylate |
| 7-amino-5-chloro-2-ethoxycarbonylindole |
| 2-ethoxycarbonyl-5-chloro-7-aminoindole |
| 7-Amino-5-chloroindole-2-carboxylic acid ethyl ester |