7-chloro-2-methylquinoline-4-carboxylic acid
Modify Date: 2024-01-13 17:33:44
7-chloro-2-methylquinoline-4-carboxylic acid structure
|
Common Name | 7-chloro-2-methylquinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 59666-15-8 | Molecular Weight | 221.64000 | |
| Density | 1.406g/cm3 | Boiling Point | 377.3ºC at 760 mmHg | |
| Molecular Formula | C11H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182ºC | |
| Name | 7-chloro-2-methylquinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 377.3ºC at 760 mmHg |
| Molecular Formula | C11H8ClNO2 |
| Molecular Weight | 221.64000 |
| Flash Point | 182ºC |
| Exact Mass | 221.02400 |
| PSA | 50.19000 |
| LogP | 2.89480 |
| Index of Refraction | 1.669 |
| InChIKey | WOONUCDWZWZHGF-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)O)c2ccc(Cl)cc2n1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-chloro-2-methyl-quinoline-4-carboxylic acid |
| 7-chloro-2-methyl-4-quinolinecarboxylic acid |