Lepidiline B structure
|
Common Name | Lepidiline B | ||
|---|---|---|---|---|
| CAS Number | 596093-97-9 | Molecular Weight | 328.87900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H25ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lepidiline BLepidiline B is a flavonolignan isolated from the roots of Brassicaceae Lepidium meyenii. Lepidiline B exhibits anti-inflammation activities in human cancer cell lines[1][2]. |
| Name | 1,3-dibenzyl-2,4,5-trimethyl-1,2-dihydroimidazol-1-ium,chloride |
|---|---|
| Synonym | More Synonyms |
| Description | Lepidiline B is a flavonolignan isolated from the roots of Brassicaceae Lepidium meyenii. Lepidiline B exhibits anti-inflammation activities in human cancer cell lines[1][2]. |
|---|---|
| Related Catalog | |
| References |
[1]. Baoliang Cui, et al. Imidazole alkaloids from Lepidium meyenii. J Nat Prod. 2003 Aug;66(8):1101-3. |
| Molecular Formula | C20H25ClN2 |
|---|---|
| Molecular Weight | 328.87900 |
| Exact Mass | 328.17100 |
| PSA | 6.48000 |
| LogP | 5.27960 |
| InChIKey | VVNHJXQBUXJGBN-UHFFFAOYSA-M |
| SMILES | Cc1c(C)[n+](Cc2ccccc2)c(C)n1Cc1ccccc1.[Cl-] |
| 1H-Imidazolium,2,4,5-trimethyl-1,3-bis(phenylmethyl)-,chloride |