Algestone
Modify Date: 2025-08-23 15:18:59
Algestone structure
|
Common Name | Algestone | ||
|---|---|---|---|---|
| CAS Number | 595-77-7 | Molecular Weight | 346.46100 | |
| Density | 1.21 g/cm3 | Boiling Point | 503.4ºC at 760 mmHg | |
| Molecular Formula | C21H30O4 | Melting Point | 210-225ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of AlgestoneAlgestone is a synthetic progestational dihydroxy derivative of Progesterone. The acetonide group possesses anti-inflammatory properties. |
| Name | algestone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21 g/cm3 |
|---|---|
| Boiling Point | 503.4ºC at 760 mmHg |
| Melting Point | 210-225ºC |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.46100 |
| Exact Mass | 346.21400 |
| PSA | 74.60000 |
| LogP | 2.80920 |
| Index of Refraction | 1.576 |
| InChIKey | CXDWHYOBSJTRJU-SRWWVFQWSA-N |
| SMILES | CC(=O)C1(O)C(O)CC2C3CCC4=CC(=O)CCC4(C)C3CCC21C |
|
~85%
Algestone CAS#:595-77-7 |
| Literature: Kym; Carlson; Katzenellenbogen Journal of Medicinal Chemistry, 1993 , vol. 36, # 9 p. 1111 - 1119 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 16alpha,17-Dihydroxypregn-4-ene-3,20-dione |
| EINECS 209-869-2 |
| Algestonum |
| ALGESTONE |
| MFCD00271948 |
| (8R,9S,10R,13S,14S,16R,17S)-17-acetyl-16,17-dihydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| Alphasone |
| Algestona |