3-[2-(3-methylphenyl)-2-oxo-ethyl]benzonitrile structure
|
Common Name | 3-[2-(3-methylphenyl)-2-oxo-ethyl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 59483-72-6 | Molecular Weight | 235.28100 | |
| Density | 1.14g/cm3 | Boiling Point | 406.1ºC at 760 mmHg | |
| Molecular Formula | C16H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | 3-[2-(3-methylphenyl)-2-oxoethyl]benzonitrile |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 406.1ºC at 760 mmHg |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.28100 |
| Flash Point | 199.4ºC |
| Exact Mass | 235.10000 |
| PSA | 40.86000 |
| LogP | 3.29208 |
| Index of Refraction | 1.595 |
| InChIKey | FDFOYUIBDVLIBR-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)Cc2cccc(C#N)c2)c1 |
|
~%
3-[2-(3-methylp... CAS#:59483-72-6 |
| Literature: Kaiser,E.N.; Petty,J.D. Journal of Organometallic Chemistry, 1976 , vol. 107, p. 219 - 228 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |