2-(3-hydroxyphenyl)isoindole-1,3-dione
Modify Date: 2025-08-25 09:11:49
2-(3-hydroxyphenyl)isoindole-1,3-dione structure
|
Common Name | 2-(3-hydroxyphenyl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 59479-66-2 | Molecular Weight | 239.22600 | |
| Density | 1.448g/cm3 | Boiling Point | 474.7ºC at 760 mmHg | |
| Molecular Formula | C14H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-hydroxyphenyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.448g/cm3 |
|---|---|
| Boiling Point | 474.7ºC at 760 mmHg |
| Molecular Formula | C14H9NO3 |
| Molecular Weight | 239.22600 |
| Exact Mass | 239.05800 |
| PSA | 57.61000 |
| LogP | 2.25780 |
| Index of Refraction | 1.701 |
| InChIKey | FZZOXPGVXDMPMS-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(O)c1 |
|
~96%
2-(3-hydroxyphe... CAS#:59479-66-2 |
| Literature: Le, Zhang-Gao; Chen, Zhen-Chu; Hu, Yi; Zheng, Qin-Guo Journal of Heterocyclic Chemistry, 2005 , vol. 42, # 4 p. 735 - 737 |
| 2-(3-hydroxyphenyl)benzo[c]azolidine-1,3-dione |
| 1h-isoindole-1,3(2h)-dione,2-(3-hydroxyphenyl) |
| 2-(3-hydroxyphenyl)-1H-isoindole-1,3(2H)-dione |
| N-(3-Hydroxy-phenyl)-phthalimid |
| N-(3-hydroxy-phenyl)-phthalimide |