2,5-diphenyl-1,4-dithiine 1,1,4,4-tetraoxide structure
|
Common Name | 2,5-diphenyl-1,4-dithiine 1,1,4,4-tetraoxide | ||
|---|---|---|---|---|
| CAS Number | 59412-21-4 | Molecular Weight | 332.39400 | |
| Density | 1.441g/cm3 | Boiling Point | 614.7ºC at 760 mmHg | |
| Molecular Formula | C16H12O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 419.9ºC | |
| Name | 2,5-diphenyl-1,4-dithiine 1,1,4,4-tetraoxide |
|---|
| Density | 1.441g/cm3 |
|---|---|
| Boiling Point | 614.7ºC at 760 mmHg |
| Molecular Formula | C16H12O4S2 |
| Molecular Weight | 332.39400 |
| Flash Point | 419.9ºC |
| Exact Mass | 332.01800 |
| PSA | 85.04000 |
| LogP | 4.98840 |
| Index of Refraction | 1.658 |
| InChIKey | YNGKTLMTTOQZRW-UHFFFAOYSA-N |
| SMILES | O=S1(=O)C=C(c2ccccc2)S(=O)(=O)C=C1c1ccccc1 |
|
~%
2,5-diphenyl-1,... CAS#:59412-21-4 |
| Literature: Szmant; Dixon Journal of the American Chemical Society, 1953 , vol. 75, p. 4354 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |