dimethyl 4-iodobenzene-1,2-dicarboxylate
Modify Date: 2025-11-12 13:03:53
dimethyl 4-iodobenzene-1,2-dicarboxylate structure
|
Common Name | dimethyl 4-iodobenzene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 59340-47-5 | Molecular Weight | 320.08100 | |
| Density | 1.708g/cm3 | Boiling Point | 330.4ºC at 760 mmHg | |
| Molecular Formula | C10H9IO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.6ºC | |
| Name | dimethyl 4-iodobenzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.708g/cm3 |
|---|---|
| Boiling Point | 330.4ºC at 760 mmHg |
| Molecular Formula | C10H9IO4 |
| Molecular Weight | 320.08100 |
| Flash Point | 153.6ºC |
| Exact Mass | 319.95500 |
| PSA | 52.60000 |
| LogP | 1.86440 |
| Index of Refraction | 1.584 |
| InChIKey | JVLGGEVUYARXHI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(I)cc1C(=O)OC |
|
~80%
dimethyl 4-iodo... CAS#:59340-47-5 |
| Literature: APOSENSE LTD.; VAN GELDER, Joel M.; LEVY, Menashe; ARGOV, Mirit; BEN-AMI, Miri; ZIV, Ilan Patent: WO2013/150534 A1, 2013 ; Location in patent: Paragraph 00103; 00104 ; |
|
~%
dimethyl 4-iodo... CAS#:59340-47-5 |
| Literature: APOSENSE LTD.; VAN GELDER, Joel M.; LEVY, Menashe; ARGOV, Mirit; BEN-AMI, Miri; ZIV, Ilan Patent: WO2013/150534 A1, 2013 ; |
|
~%
dimethyl 4-iodo... CAS#:59340-47-5 |
| Literature: Kenner; Mathews Journal of the Chemical Society, 1914 , vol. 105, p. 2480 |
| 4-iodo-phthalic acid dimethyl ester |
| dimethyl 4-iodophthalate |
| EINECS 261-711-1 |
| 1,2-Benzenedicarboxylicacid,4-iodo-,1,2-dimethyl ester |
| 4-Jod-phthalsaeure-dimethylester |