4-(2-hydroxyethylamino)-3-nitrobenzoic acid
Modify Date: 2025-08-25 11:31:13
4-(2-hydroxyethylamino)-3-nitrobenzoic acid structure
|
Common Name | 4-(2-hydroxyethylamino)-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 59320-14-8 | Molecular Weight | 226.18600 | |
| Density | 1.535 g/cm3 | Boiling Point | 485.3ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.3ºC | |
| Name | 4-(2-hydroxyethylamino)-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.535 g/cm3 |
|---|---|
| Boiling Point | 485.3ºC at 760 mmHg |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.18600 |
| Flash Point | 247.3ºC |
| Exact Mass | 226.05900 |
| PSA | 115.38000 |
| LogP | 1.29340 |
| Index of Refraction | 1.677 |
| InChIKey | KRTQQHYYZBCHED-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NCCO)c([N+](=O)[O-])c1 |
| HS Code | 2922509090 |
|---|
|
~96%
4-(2-hydroxyeth... CAS#:59320-14-8 |
| Literature: METHYLGENE INC. Patent: WO2007/118137 A1, 2007 ; Location in patent: Page/Page column 112-113 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:279227-02-0| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(2-hydroxy-ethylamino)-3-nitro-benzoic acid |