ethyl 4-[4-[2-(4-methoxyphenyl)acetyl]-3-methylpiperazine-1-carbonyl]-2-methyl-6-propylpyrimidine-5-carboxylate structure
|
Common Name | ethyl 4-[4-[2-(4-methoxyphenyl)acetyl]-3-methylpiperazine-1-carbonyl]-2-methyl-6-propylpyrimidine-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5929-78-2 | Molecular Weight | 482.57200 | |
| Density | 1.182g/cm3 | Boiling Point | 676.4ºC at 760 mmHg | |
| Molecular Formula | C26H34N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 362.9ºC | |
| Name | ethyl 4-[4-[2-(4-methoxyphenyl)acetyl]-3-methylpiperazine-1-carbonyl]-2-methyl-6-propylpyrimidine-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 676.4ºC at 760 mmHg |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.57200 |
| Flash Point | 362.9ºC |
| Exact Mass | 482.25300 |
| PSA | 101.93000 |
| LogP | 2.71420 |
| Index of Refraction | 1.559 |
| InChIKey | WSYNNVTUKAQTRP-UHFFFAOYSA-N |
| SMILES | CCCc1nc(C)nc(C(=O)N2CCN(C(=O)Cc3ccc(OC)cc3)C(C)C2)c1C(=O)OCC |
|
~%
ethyl 4-[4-[2-(... CAS#:5929-78-2 |
| Literature: Petrov,A.A. et al. Journal of Organic Chemistry USSR (English Translation), 1965 , vol. 1, # 12 p. 2144 - 2147 Zhurnal Organicheskoi Khimii, 1965 , vol. 1, # 12 p. 2101 - 2105 |
| 1,3-dichloro-4-methoxy-butan-2-one |
| ETHYL 4-[4-[2-(4-METHOXYPHENYL)ACETYL]-3-METHYL-PIPERAZINE-1-CARBONYL]-2-METHYL-6-PROPYL-PYRIMIDINE-5-CARBOXYLATE |