1-ethenyl-2-ethenylsulfanyl-4,5-diphenylimidazole
Modify Date: 2025-11-26 11:20:16
1-ethenyl-2-ethenylsulfanyl-4,5-diphenylimidazole structure
|
Common Name | 1-ethenyl-2-ethenylsulfanyl-4,5-diphenylimidazole | ||
|---|---|---|---|---|
| CAS Number | 59282-92-7 | Molecular Weight | 304.40900 | |
| Density | 1.08g/cm3 | Boiling Point | 486.1ºC at 760 mmHg | |
| Molecular Formula | C19H16N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.8ºC | |
| Name | 1-ethenyl-2-ethenylsulfanyl-4,5-diphenylimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 486.1ºC at 760 mmHg |
| Molecular Formula | C19H16N2S |
| Molecular Weight | 304.40900 |
| Flash Point | 247.8ºC |
| Exact Mass | 304.10300 |
| PSA | 43.12000 |
| LogP | 5.55320 |
| Index of Refraction | 1.605 |
| InChIKey | SZDFHZRXSULOIT-UHFFFAOYSA-N |
| SMILES | C=CSc1nc(-c2ccccc2)c(-c2ccccc2)n1C=C |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,S-Divinyl-4,5-diphenyl vinyl sulfide |
| 4,5-diphenyl-1-vinyl-2-vinylsulfanyl-1H-imidazole |
| 4,5-Diphenyl-1-vinyl-2-(vinylthio)imidazole |
| Imidazole,4,5-diphenyl-1-vinyl-2-(vinylthio) |