2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione structure
|
Common Name | 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 59280-75-0 | Molecular Weight | 281.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10F3NO2 |
|---|---|
| Molecular Weight | 281.23000 |
| Exact Mass | 281.06600 |
| PSA | 37.38000 |
| LogP | 2.91270 |
| InChIKey | CGNDKGLHBJCRHZ-UHFFFAOYSA-N |
| SMILES | O=C1C2=C(CCCC2)C(=O)N1c1c(F)cc(F)cc1F |
| HS Code | 2925190090 |
|---|
|
~%
2-(2,4,6-triflu... CAS#:59280-75-0 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4001272 A1, 1977 ; |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1H-Isoindole-1,3(2H)-dione,4,5,6,7-tetrahydro-2-(2,4,6-trifluorophenyl) |
| 2-(2,4,6-trifluorophenyl)-4,5,6,7-tetrahydro-2H-isoindole-1,3-dione |