2-(4-chloro-2-fluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione structure
|
Common Name | 2-(4-chloro-2-fluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 59280-72-7 | Molecular Weight | 279.69400 | |
| Density | 1.44g/cm3 | Boiling Point | 416.5ºC at 760 mmHg | |
| Molecular Formula | C14H11ClFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.7ºC | |
| Name | 2-(4-chloro-2-fluorophenyl)-4,5,6,7-tetrahydroisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 416.5ºC at 760 mmHg |
| Molecular Formula | C14H11ClFNO2 |
| Molecular Weight | 279.69400 |
| Flash Point | 205.7ºC |
| Exact Mass | 279.04600 |
| PSA | 37.38000 |
| LogP | 3.28790 |
| Index of Refraction | 1.624 |
| HS Code | 2925190090 |
|---|
|
~%
2-(4-chloro-2-f... CAS#:59280-72-7 |
| Literature: Sato, Yukiharu; Kojima, Takashi; Goto, Toshiyuki; Oomikawa, Reiko; Watanabe, Hiroyuki; Wakabayashi, Ko Agricultural and Biological Chemistry, 1991 , vol. 55, # 11 p. 2677 - 2682 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(4-chloro-2-fluorophenyl)-2,3,4,5,6,7-hexahydro-1H-isoindol-1,3-dione |
| 2-(4-chloro-2-fluorophenyl)-4,5,6,7-tetrahydro-2H-isoindole-1,3-dione |
| N-(2-fluoro-4-chlorophenyl)-3,4,5,6-tetrahydrophthalimide |
| 2-(4-chloro-2-fluorophenyl)-4,5,6,7-tetrahydro-1h-isoindole-1,3(2h)-dione |