N-[2-(2,4-dichlorophenoxy)ethyl]-1-benzofuran-2-carboxamide
Modify Date: 2025-09-24 19:00:27
![N-[2-(2,4-dichlorophenoxy)ethyl]-1-benzofuran-2-carboxamide Structure](https://image.chemsrc.com/caspic/312/5927-94-6.png)
N-[2-(2,4-dichlorophenoxy)ethyl]-1-benzofuran-2-carboxamide structure
|
Common Name | N-[2-(2,4-dichlorophenoxy)ethyl]-1-benzofuran-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5927-94-6 | Molecular Weight | 350.19600 | |
| Density | 1.37g/cm3 | Boiling Point | 562.8ºC at 760 mmHg | |
| Molecular Formula | C17H13Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.2ºC | |
| Name | N-[2-(2,4-dichlorophenoxy)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 562.8ºC at 760 mmHg |
| Molecular Formula | C17H13Cl2NO3 |
| Molecular Weight | 350.19600 |
| Flash Point | 294.2ºC |
| Exact Mass | 349.02700 |
| PSA | 54.96000 |
| LogP | 5.12320 |
| Index of Refraction | 1.628 |
| InChIKey | GJGLIXMDXUAJFA-UHFFFAOYSA-N |
| SMILES | O=C(NCCOc1ccc(Cl)cc1Cl)c1cc2ccccc2o1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| trans-1-methoxy-2-bromoindane |
| N-[2-(2,4-DICHLOROPHENOXY)ETHYL]BENZOFURAN-2-CARBOXAMIDE |
| trans-2-bromo-1-methyloxyindan |
| trans-2-bromo-1-methoxyindane |