1-(1,3-dioxolan-2-yl)-4-methyl-5-nitro-isoquinoline structure
|
Common Name | 1-(1,3-dioxolan-2-yl)-4-methyl-5-nitro-isoquinoline | ||
|---|---|---|---|---|
| CAS Number | 59261-42-6 | Molecular Weight | 260.24500 | |
| Density | 1.366g/cm3 | Boiling Point | 465.5ºC at 760 mmHg | |
| Molecular Formula | C13H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.3ºC | |
| Name | 1-(1,3-dioxolan-2-yl)-4-methyl-5-nitroisoquinoline |
|---|
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 465.5ºC at 760 mmHg |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.24500 |
| Flash Point | 235.3ºC |
| Exact Mass | 260.08000 |
| PSA | 77.17000 |
| LogP | 3.02000 |
| Index of Refraction | 1.642 |
| InChIKey | MPPBGGVPUGGSPX-UHFFFAOYSA-N |
| SMILES | Cc1cnc(C2OCCO2)c2cccc([N+](=O)[O-])c12 |
|
~%
1-(1,3-dioxolan... CAS#:59261-42-6 |
| Literature: Agrawal; Mooney; Sartorelli Journal of Medicinal Chemistry, 1976 , vol. 19, # 7 p. 970 - 972 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |