1-(4-bromophenyl)-3-(3,4-dimethylanilino)propan-1-one
Modify Date: 2025-08-29 18:00:36
1-(4-bromophenyl)-3-(3,4-dimethylanilino)propan-1-one structure
|
Common Name | 1-(4-bromophenyl)-3-(3,4-dimethylanilino)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 5926-46-5 | Molecular Weight | 332.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-bromophenyl)-3-(3,4-dimethylanilino)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18BrNO |
|---|---|
| Molecular Weight | 332.23500 |
| Exact Mass | 331.05700 |
| PSA | 29.10000 |
| LogP | 4.82380 |
| InChIKey | OXYJFAZQWLNRBR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NCCC(=O)c2ccc(Br)cc2)cc1C |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| js-2395 |