3-[(4-ethoxyphenyl)carbamoyl]propanoic acid
Modify Date: 2025-09-24 19:31:52
![3-[(4-ethoxyphenyl)carbamoyl]propanoic acid Structure](https://image.chemsrc.com/caspic/314/59256-45-0.png)
3-[(4-ethoxyphenyl)carbamoyl]propanoic acid structure
|
Common Name | 3-[(4-ethoxyphenyl)carbamoyl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 59256-45-0 | Molecular Weight | 237.25200 | |
| Density | 1.244g/cm3 | Boiling Point | 494.7ºC at 760 mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253ºC | |
| Name | 4-(4-ethoxyanilino)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 494.7ºC at 760 mmHg |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25200 |
| Flash Point | 253ºC |
| Exact Mass | 237.10000 |
| PSA | 75.63000 |
| LogP | 1.96160 |
| Index of Refraction | 1.571 |
| InChIKey | YXCPMPAALKOYQA-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(NC(=O)CCC(=O)O)cc1 |
| HS Code | 2922509090 |
|---|
CAS#:108-30-5
CAS#:156-43-4
CAS#:19077-60-2
CAS#:611-41-6| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Bernsteinsaeure-mono-p-ethoxy-anilid |
| Bernsteinsaeure-mono-<4-aethoxy-anilid> |
| Bernsteinsaeure-mono-p-phenetidid |